About 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide
4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide (PubChem CID 122181672) has the molecular formula C17H14ClN3O5S2
and a molecular weight of 439.90 g/mol. Its IUPAC name is 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide.
Molecular Properties
| Compound Name | 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide |
| PubChem CID | 122181672 |
| Molecular Formula | C17H14ClN3O5S2 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(NC(=O)Cn2c(=O)sc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C17H14ClN3O5S2/c1-28(25,26)20-16(23)10-2-5-12(6-3-10)19-15(22)9-21-13-8-11(18)4-7-14(13)27-17(21)24/h2-8H,9H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | UBSSUXIQWAFWFZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide?
The IUPAC name of 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide (CID 122181672) is 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide.
What is the SMILES notation for 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide?
The canonical SMILES for 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide is CS(=O)(=O)NC(=O)c1ccc(NC(=O)Cn2c(=O)sc3ccc(Cl)cc32)cc1.
What is the InChIKey of 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide?
The InChIKey is UBSSUXIQWAFWFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClN3O5S2/c1-28(25,26)20-16(23)10-2-5-12(6-3-10)19-15(22)9-21-13-8-11(18)4-7-14(13)27-17(21)24/h2-8H,9H2,1H3,(H,19,22)(H,20,23).
What are the key properties of 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide?
4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide has a molecular weight of 439.90 g/mol, XLogP of 2.04, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(5-chloro-2-oxo-1,3-benzothiazol-3-yl)acetyl]amino]-N-methylsulfonylbenzamide is sourced from PubChem (CID 122181672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).