C17H24BrNO2 — CID 63444181
6-(1-bromooctyl)-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 63444181) has the molecular formula C17H24BrNO2 and a molecular weight of 354.29 g/mol. Its IUPAC name is 6-(1-bromooctyl)-3-ethyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-bromooctyl)-3-ethyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 63444181 |
| Molecular Formula | C17H24BrNO2 |
| Molecular Weight | 354.29 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 6-(1-bromooctyl)-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCCCCCCC(Br)c1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C17H24BrNO2/c1-3-5-6-7-8-9-14(18)13-10-11-15-16(12-13)21-17(20)19(15)4-2/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | MOOQJFLQHSFGGC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.29 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|