C15H20BrNO2 — CID 114876162
6-(1-bromo-3-methylpentyl)-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 114876162) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is 6-(1-bromo-3-methylpentyl)-3-ethyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(1-bromo-3-methylpentyl)-3-ethyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 114876162 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 6-(1-bromo-3-methylpentyl)-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCC(C)CC(Br)c1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C15H20BrNO2/c1-4-10(3)8-12(16)11-6-7-13-14(9-11)19-15(18)17(13)5-2/h6-7,9-10,12H,4-5,8H2,1-3H3 |
| InChIKey | ZVBSIVRBCLBGQM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|