C11H10N2O5 — CID 115141348
2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]-2-oxoacetic acid (PubChem CID 115141348) has the molecular formula C11H10N2O5 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]-2-oxoacetic acid.
| Compound Name | 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 115141348 |
| Molecular Formula | C11H10N2O5 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)methylamino]-2-oxoacetic acid |
| SMILES | Cn1c(=O)oc2cc(CNC(=O)C(=O)O)ccc21 |
| InChI | InChI=1S/C11H10N2O5/c1-13-7-3-2-6(4-8(7)18-11(13)17)5-12-9(14)10(15)16/h2-4H,5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | RFTVBNIYURQQPZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|