C13H11ClF3NO2 — CID 103474326
1-(7-chloro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103474326) has the molecular formula C13H11ClF3NO2 and a molecular weight of 305.68 g/mol. Its IUPAC name is 1-(7-chloro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(7-chloro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103474326 |
| Molecular Formula | C13H11ClF3NO2 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 1-(7-chloro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1c[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C13H11ClF3NO2/c14-10-3-1-2-8-9(6-18-12(8)10)11(19)4-5-20-7-13(15,16)17/h1-3,6,18H,4-5,7H2 |
| InChIKey | UZZSHCJZBVWGRM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|