C13H11F4NO2 — CID 103206688
1-(5-fluoro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103206688) has the molecular formula C13H11F4NO2 and a molecular weight of 289.23 g/mol. Its IUPAC name is 1-(5-fluoro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(5-fluoro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103206688 |
| Molecular Formula | C13H11F4NO2 |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-(5-fluoro-1H-indol-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | O=C(CCOCC(F)(F)F)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C13H11F4NO2/c14-8-1-2-11-9(5-8)10(6-18-11)12(19)3-4-20-7-13(15,16)17/h1-2,5-6,18H,3-4,7H2 |
| InChIKey | SXPJJSTYGBZQQP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|