C12H12F2O2 — CID 116992787
2-[3-[cyclopropyl(difluoro)methyl]phenyl]acetic acid (PubChem CID 116992787) has the molecular formula C12H12F2O2 and a molecular weight of 226.22 g/mol. Its IUPAC name is 2-[3-[cyclopropyl(difluoro)methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[cyclopropyl(difluoro)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 116992787 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-[3-[cyclopropyl(difluoro)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(C(F)(F)C2CC2)c1 |
| InChI | InChI=1S/C12H12F2O2/c13-12(14,9-4-5-9)10-3-1-2-8(6-10)7-11(15)16/h1-3,6,9H,4-5,7H2,(H,15,16) |
| InChIKey | OHQCTQIHHMXOSO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |