C19H21NO6 — CID 18192145
[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate (PubChem CID 18192145) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate.
| Compound Name | [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 18192145 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | [2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl] 2-hydroxy-3-methoxybenzoate |
| SMILES | COc1ccccc1C(C)NC(=O)COC(=O)c1cccc(OC)c1O |
| InChI | InChI=1S/C19H21NO6/c1-12(13-7-4-5-9-15(13)24-2)20-17(21)11-26-19(23)14-8-6-10-16(25-3)18(14)22/h4-10,12,22H,11H2,1-3H3,(H,20,21) |
| InChIKey | CVYGKSLNAHEHKP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |