C22H19Cl2N3O4S2 — CID 4857026
N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide (PubChem CID 4857026) has the molecular formula C22H19Cl2N3O4S2 and a molecular weight of 524.45 g/mol. Its IUPAC name is N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide.
| Compound Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 4857026 |
| Molecular Formula | C22H19Cl2N3O4S2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | N-(5-acetyl-4-methyl-1,3-thiazol-2-yl)-4-chloro-3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1cc(C(=O)Nc2nc(C)c(C(C)=O)s2)ccc1Cl |
| InChI | InChI=1S/C22H19Cl2N3O4S2/c1-4-11-27(17-8-6-16(23)7-9-17)33(30,31)19-12-15(5-10-18(19)24)21(29)26-22-25-13(2)20(32-22)14(3)28/h4-10,12H,1,11H2,2-3H3,(H,25,26,29) |
| InChIKey | ZLOIDVUMKNGRGC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|