C20H19ClN4O3S2 — CID 112791289
3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 112791289) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 112791289 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 3-[(4-chlorophenyl)-prop-2-enylsulfamoyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCN(c1ccc(Cl)cc1)S(=O)(=O)c1cccc(C(=O)Nc2nnc(CC)s2)c1 |
| InChI | InChI=1S/C20H19ClN4O3S2/c1-3-12-25(16-10-8-15(21)9-11-16)30(27,28)17-7-5-6-14(13-17)19(26)22-20-24-23-18(4-2)29-20/h3,5-11,13H,1,4,12H2,2H3,(H,22,24,26) |
| InChIKey | AXPTXASVKRRSMM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|