C19H18ClNO5 — CID 8982982
[(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate (PubChem CID 8982982) has the molecular formula C19H18ClNO5 and a molecular weight of 375.81 g/mol. Its IUPAC name is [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate.
| Compound Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8982982 |
| Molecular Formula | C19H18ClNO5 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [(2R)-1-(2-acetylanilino)-1-oxopropan-2-yl] 2-(3-chlorophenoxy)acetate |
| SMILES | CC(=O)c1ccccc1NC(=O)[C@@H](C)OC(=O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18ClNO5/c1-12(22)16-8-3-4-9-17(16)21-19(24)13(2)26-18(23)11-25-15-7-5-6-14(20)10-15/h3-10,13H,11H2,1-2H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | GPEZVIAUDYHDHB-CYBMUJFWSA-N |
| XLogP | 3.49 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |