C20H19BrCl3NO4 — CID 90691170
[4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] pentanoate (PubChem CID 90691170) has the molecular formula C20H19BrCl3NO4 and a molecular weight of 523.64 g/mol. Its IUPAC name is [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] pentanoate.
| Compound Name | [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] pentanoate |
|---|---|
| PubChem CID | 90691170 |
| Molecular Formula | C20H19BrCl3NO4 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1cc(Cl)c(Oc2ccc(NC(=O)C(C)Cl)c(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H19BrCl3NO4/c1-3-4-5-18(26)28-13-9-15(23)19(16(24)10-13)29-12-6-7-17(14(21)8-12)25-20(27)11(2)22/h6-11H,3-5H2,1-2H3,(H,25,27) |
| InChIKey | RKNQVUSPLHUECL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|