C18H15BrCl3NO4 — CID 91075323
[4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] propanoate (PubChem CID 91075323) has the molecular formula C18H15BrCl3NO4 and a molecular weight of 495.58 g/mol. Its IUPAC name is [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] propanoate.
| Compound Name | [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] propanoate |
|---|---|
| PubChem CID | 91075323 |
| Molecular Formula | C18H15BrCl3NO4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 492.93 |
| IUPAC Name | [4-[3-bromo-4-(2-chloropropanoylamino)phenoxy]-3,5-dichlorophenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Cl)c(Oc2ccc(NC(=O)C(C)Cl)c(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H15BrCl3NO4/c1-3-16(24)26-11-7-13(21)17(14(22)8-11)27-10-4-5-15(12(19)6-10)23-18(25)9(2)20/h4-9H,3H2,1-2H3,(H,23,25) |
| InChIKey | JXZXYDJFVUITBZ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|