C11H13ClO4 — CID 130431285
(3-chloro-4,5-dimethoxyphenyl) propanoate (PubChem CID 130431285) has the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. Its IUPAC name is (3-chloro-4,5-dimethoxyphenyl) propanoate.
| Compound Name | (3-chloro-4,5-dimethoxyphenyl) propanoate |
|---|---|
| PubChem CID | 130431285 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (3-chloro-4,5-dimethoxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C11H13ClO4/c1-4-10(13)16-7-5-8(12)11(15-3)9(6-7)14-2/h5-6H,4H2,1-3H3 |
| InChIKey | QRPWMIIVOOKLBX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|