C19H18Cl3NO4 — CID 91003031
[3,5-dichloro-4-[3-chloro-4-(2-methylpropanoylamino)phenoxy]phenyl] propanoate (PubChem CID 91003031) has the molecular formula C19H18Cl3NO4 and a molecular weight of 430.72 g/mol. Its IUPAC name is [3,5-dichloro-4-[3-chloro-4-(2-methylpropanoylamino)phenoxy]phenyl] propanoate.
| Compound Name | [3,5-dichloro-4-[3-chloro-4-(2-methylpropanoylamino)phenoxy]phenyl] propanoate |
|---|---|
| PubChem CID | 91003031 |
| Molecular Formula | C19H18Cl3NO4 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | [3,5-dichloro-4-[3-chloro-4-(2-methylpropanoylamino)phenoxy]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(Cl)c(Oc2ccc(NC(=O)C(C)C)c(Cl)c2)c(Cl)c1 |
| InChI | InChI=1S/C19H18Cl3NO4/c1-4-17(24)26-12-8-14(21)18(15(22)9-12)27-11-5-6-16(13(20)7-11)23-19(25)10(2)3/h5-10H,4H2,1-3H3,(H,23,25) |
| InChIKey | QIUWMKKAOKJAAZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|