C25H23Cl2NO4 — CID 87837670
[3,5-dichloro-2-methyl-4-[4-(2-methylpropanoylamino)-3-phenylphenoxy]phenyl] acetate (PubChem CID 87837670) has the molecular formula C25H23Cl2NO4 and a molecular weight of 472.37 g/mol. Its IUPAC name is [3,5-dichloro-2-methyl-4-[4-(2-methylpropanoylamino)-3-phenylphenoxy]phenyl] acetate.
| Compound Name | [3,5-dichloro-2-methyl-4-[4-(2-methylpropanoylamino)-3-phenylphenoxy]phenyl] acetate |
|---|---|
| PubChem CID | 87837670 |
| Molecular Formula | C25H23Cl2NO4 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [3,5-dichloro-2-methyl-4-[4-(2-methylpropanoylamino)-3-phenylphenoxy]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(Cl)c(Oc2ccc(NC(=O)C(C)C)c(-c3ccccc3)c2)c(Cl)c1C |
| InChI | InChI=1S/C25H23Cl2NO4/c1-14(2)25(30)28-21-11-10-18(12-19(21)17-8-6-5-7-9-17)32-24-20(26)13-22(31-16(4)29)15(3)23(24)27/h5-14H,1-4H3,(H,28,30) |
| InChIKey | FCYNJPOFTMDQSR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|