About [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate
[2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate (PubChem CID 19170420) has the molecular formula C18H16BrNO6
and a molecular weight of 422.23 g/mol. Its IUPAC name is [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate.
Molecular Properties
| Compound Name | [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate |
| PubChem CID | 19170420 |
| Molecular Formula | C18H16BrNO6 |
| Molecular Weight | 422.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)Oc1c(Br)cc(/C=C/[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H16BrNO6/c1-3-25-15-7-5-4-6-13(15)18(21)26-17-14(19)10-12(8-9-20(22)23)11-16(17)24-2/h4-11H,3H2,1-2H3/b9-8+ |
| InChIKey | BZKGDDMYRCRGDK-CMDGGOBGSA-N |
| XLogP | 4.32 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate?
The IUPAC name of [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate (CID 19170420) is [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate.
What is the SMILES notation for [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate?
The canonical SMILES for [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate is CCOc1ccccc1C(=O)Oc1c(Br)cc(/C=C/[N+](=O)[O-])cc1OC.
What is the InChIKey of [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate?
The InChIKey is BZKGDDMYRCRGDK-CMDGGOBGSA-N. The full InChI is InChI=1S/C18H16BrNO6/c1-3-25-15-7-5-4-6-13(15)18(21)26-17-14(19)10-12(8-9-20(22)23)11-16(17)24-2/h4-11H,3H2,1-2H3/b9-8+.
What are the key properties of [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate?
[2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate has a molecular weight of 422.23 g/mol, XLogP of 4.32, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-bromo-6-methoxy-4-[(E)-2-nitroethenyl]phenyl] 2-ethoxybenzoate is sourced from PubChem (CID 19170420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).