C20H20Br2N2O5 — CID 126012975
N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(Z)-2-nitroethenyl]phenoxy]acetamide (PubChem CID 126012975) has the molecular formula C20H20Br2N2O5 and a molecular weight of 528.20 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(Z)-2-nitroethenyl]phenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(Z)-2-nitroethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126012975 |
| Molecular Formula | C20H20Br2N2O5 |
| Molecular Weight | 528.20 g/mol |
| Exact Mass | 525.97 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-6-ethoxy-4-[(Z)-2-nitroethenyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C\[N+](=O)[O-])cc(Br)c1OCC(=O)Nc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C20H20Br2N2O5/c1-4-28-18-10-14(5-6-24(26)27)9-16(22)20(18)29-11-19(25)23-17-8-13(3)12(2)7-15(17)21/h5-10H,4,11H2,1-3H3,(H,23,25)/b6-5- |
| InChIKey | IZSWBEITUXDXJF-WAYWQWQTSA-N |
| XLogP | 5.49 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|