C25H23Br2N5O7 — CID 126011785
N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetamide (PubChem CID 126011785) has the molecular formula C25H23Br2N5O7 and a molecular weight of 665.30 g/mol. Its IUPAC name is N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetamide.
| Compound Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 126011785 |
| Molecular Formula | C25H23Br2N5O7 |
| Molecular Weight | 665.30 g/mol |
| Exact Mass | 663.00 |
| IUPAC Name | N-(2-bromo-4,5-dimethylphenyl)-2-[2-bromo-4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-6-ethoxyphenoxy]acetamide |
| SMILES | CCOc1cc(/C=N/Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(Br)c1OCC(=O)Nc1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C25H23Br2N5O7/c1-4-38-23-10-16(12-28-30-20-6-5-17(31(34)35)11-22(20)32(36)37)9-19(27)25(23)39-13-24(33)29-21-8-15(3)14(2)7-18(21)26/h5-12,30H,4,13H2,1-3H3,(H,29,33)/b28-12+ |
| InChIKey | DBVKLNWZVTYTLO-KVSWJAHQSA-N |
| XLogP | 6.51 |
| TPSA | 158.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.30 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|