C22H23Br2ClN8O6 — CID 138399424
2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2,6-dibromo-4-[(Z)-(2,4-dinitrophenoxy)iminomethyl]phenol (PubChem CID 138399424) has the molecular formula C22H23Br2ClN8O6 and a molecular weight of 690.74 g/mol. Its IUPAC name is 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2,6-dibromo-4-[(Z)-(2,4-dinitrophenoxy)iminomethyl]phenol.
| Compound Name | 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2,6-dibromo-4-[(Z)-(2,4-dinitrophenoxy)iminomethyl]phenol |
|---|---|
| PubChem CID | 138399424 |
| Molecular Formula | C22H23Br2ClN8O6 |
| Molecular Weight | 690.74 g/mol |
| Exact Mass | 687.98 |
| IUPAC Name | 2-N-tert-butyl-6-chloro-4-N-ethyl-1,3,5-triazine-2,4-diamine;2,6-dibromo-4-[(Z)-(2,4-dinitrophenoxy)iminomethyl]phenol |
| SMILES | CCNc1nc(Cl)nc(NC(C)(C)C)n1.O=[N+]([O-])c1ccc(O/N=C\c2cc(Br)c(O)c(Br)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7Br2N3O6.C9H16ClN5/c14-9-3-7(4-10(15)13(9)19)6-16-24-12-2-1-8(17(20)21)5-11(12)18(22)23;1-5-11-7-12-6(10)13-8(14-7)15-9(2,3)4/h1-6,19H;5H2,1-4H3,(H2,11,12,13,14,15)/b16-6-; |
| InChIKey | NTRTVUAPNTYURY-NKBLJONXSA-N |
| XLogP | 6.31 |
| TPSA | 190.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|