C15H11BrClN3O5 — CID 135468612
N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-chloro-4-nitrobenzamide (PubChem CID 135468612) has the molecular formula C15H11BrClN3O5 and a molecular weight of 428.63 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-chloro-4-nitrobenzamide.
| Compound Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 135468612 |
| Molecular Formula | C15H11BrClN3O5 |
| Molecular Weight | 428.63 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | N-[(E)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-chloro-4-nitrobenzamide |
| SMILES | COc1cc(/C=N/NC(=O)c2ccc([N+](=O)[O-])cc2Cl)cc(Br)c1O |
| InChI | InChI=1S/C15H11BrClN3O5/c1-25-13-5-8(4-11(16)14(13)21)7-18-19-15(22)10-3-2-9(20(23)24)6-12(10)17/h2-7,21H,1H3,(H,19,22)/b18-7+ |
| InChIKey | AONRWMWHIJYAKK-CNHKJKLMSA-N |
| XLogP | 3.49 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|