C15H12BrN3O6 — CID 136844887
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-hydroxy-5-nitrobenzamide (PubChem CID 136844887) has the molecular formula C15H12BrN3O6 and a molecular weight of 410.18 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-hydroxy-5-nitrobenzamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 136844887 |
| Molecular Formula | C15H12BrN3O6 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-hydroxy-5-nitrobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc([N+](=O)[O-])ccc2O)cc(Br)c1O |
| InChI | InChI=1S/C15H12BrN3O6/c1-25-13-5-8(4-11(16)14(13)21)7-17-18-15(22)10-6-9(19(23)24)2-3-12(10)20/h2-7,20-21H,1H3,(H,18,22)/b17-7- |
| InChIKey | XCGOYJFSPWAXQT-IDUWFGFVSA-N |
| XLogP | 2.54 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|