C16H14IN3O6 — CID 6265393
2-hydroxy-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-5-nitrobenzamide (PubChem CID 6265393) has the molecular formula C16H14IN3O6 and a molecular weight of 471.21 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-5-nitrobenzamide.
| Compound Name | 2-hydroxy-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 6265393 |
| Molecular Formula | C16H14IN3O6 |
| Molecular Weight | 471.21 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | 2-hydroxy-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]-5-nitrobenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc([N+](=O)[O-])ccc2O)cc(I)c1OC |
| InChI | InChI=1S/C16H14IN3O6/c1-25-14-6-9(5-12(17)15(14)26-2)8-18-19-16(22)11-7-10(20(23)24)3-4-13(11)21/h3-8,21H,1-2H3,(H,19,22)/b18-8- |
| InChIKey | YECCPRYJOKEHLB-LSCVHKIXSA-N |
| XLogP | 2.69 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|