C17H12BrN3O5S — CID 3886313
N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 3886313) has the molecular formula C17H12BrN3O5S and a molecular weight of 450.27 g/mol. Its IUPAC name is N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3886313 |
| Molecular Formula | C17H12BrN3O5S |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | N-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc(Br)c1O |
| InChI | InChI=1S/C17H12BrN3O5S/c1-26-13-5-9(4-12(18)16(13)22)8-19-20-17(23)15-7-10-6-11(21(24)25)2-3-14(10)27-15/h2-8,22H,1H3,(H,20,23) |
| InChIKey | OUHMZNVKLHLYBW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|