C24H17BrClN3O5S — CID 126391917
N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126391917) has the molecular formula C24H17BrClN3O5S and a molecular weight of 574.84 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126391917 |
| Molecular Formula | C24H17BrClN3O5S |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | COc1cc(/C=N/NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H17BrClN3O5S/c1-33-20-9-14(8-18(25)23(20)34-13-15-4-2-3-5-19(15)26)12-27-28-24(30)22-11-16-10-17(29(31)32)6-7-21(16)35-22/h2-12H,13H2,1H3,(H,28,30)/b27-12+ |
| InChIKey | WAVMKVAGIJUFTD-KKMKTNMSSA-N |
| XLogP | 6.58 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|