C29H22ClN3O5S — CID 126391937
N-[(Z)-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126391937) has the molecular formula C29H22ClN3O5S and a molecular weight of 560.03 g/mol. Its IUPAC name is N-[(Z)-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126391937 |
| Molecular Formula | C29H22ClN3O5S |
| Molecular Weight | 560.03 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | N-[(Z)-[3-chloro-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc(Cl)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H22ClN3O5S/c1-2-37-25-13-18(12-24(30)28(25)38-17-20-8-5-7-19-6-3-4-9-23(19)20)16-31-32-29(34)27-15-21-14-22(33(35)36)10-11-26(21)39-27/h3-16H,2,17H2,1H3,(H,32,34)/b31-16- |
| InChIKey | WJCIIXWNELCMOY-ACXHZZMFSA-N |
| XLogP | 7.36 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.03 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|