C23H14ClI2N3O4S — CID 126391358
N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126391358) has the molecular formula C23H14ClI2N3O4S and a molecular weight of 717.71 g/mol. Its IUPAC name is N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126391358 |
| Molecular Formula | C23H14ClI2N3O4S |
| Molecular Weight | 717.71 g/mol |
| Exact Mass | 716.85 |
| IUPAC Name | N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(I)c(OCc2ccccc2Cl)c(I)c1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C23H14ClI2N3O4S/c24-17-4-2-1-3-14(17)12-33-22-18(25)7-13(8-19(22)26)11-27-28-23(30)21-10-15-9-16(29(31)32)5-6-20(15)34-21/h1-11H,12H2,(H,28,30)/b27-11- |
| InChIKey | SAKMVSDDSKIXAO-BCHBDCPOSA-N |
| XLogP | 7.01 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.71 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|