C23H15FIN3O4S — CID 126390618
N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 126390618) has the molecular formula C23H15FIN3O4S and a molecular weight of 575.36 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 126390618 |
| Molecular Formula | C23H15FIN3O4S |
| Molecular Weight | 575.36 g/mol |
| Exact Mass | 574.98 |
| IUPAC Name | N-[(Z)-[4-[(3-fluorophenyl)methoxy]-3-iodophenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2cccc(F)c2)c(I)c1)c1cc2cc([N+](=O)[O-])ccc2s1 |
| InChI | InChI=1S/C23H15FIN3O4S/c24-17-3-1-2-15(8-17)13-32-20-6-4-14(9-19(20)25)12-26-27-23(29)22-11-16-10-18(28(30)31)5-7-21(16)33-22/h1-12H,13H2,(H,27,29)/b26-12- |
| InChIKey | NXPRSBSLQHTXOF-ZRGSRPPYSA-N |
| XLogP | 5.90 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|