C18H14N4O5S — CID 4587824
N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide (PubChem CID 4587824) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4587824 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-5-nitro-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)COc1ccc(C=NNC(=O)c2cc3cc([N+](=O)[O-])ccc3s2)cc1 |
| InChI | InChI=1S/C18H14N4O5S/c19-17(23)10-27-14-4-1-11(2-5-14)9-20-21-18(24)16-8-12-7-13(22(25)26)3-6-15(12)28-16/h1-9H,10H2,(H2,19,23)(H,21,24) |
| InChIKey | HGGFPMUYCWSKBP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|