C9H10N4O7 — CID 87839607
2-[(2,4-dinitrophenoxy)methyl-hydroxyamino]acetamide (PubChem CID 87839607) has the molecular formula C9H10N4O7 and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenoxy)methyl-hydroxyamino]acetamide.
| Compound Name | 2-[(2,4-dinitrophenoxy)methyl-hydroxyamino]acetamide |
|---|---|
| PubChem CID | 87839607 |
| Molecular Formula | C9H10N4O7 |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[(2,4-dinitrophenoxy)methyl-hydroxyamino]acetamide |
| SMILES | NC(=O)CN(O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N4O7/c10-9(14)4-11(15)5-20-8-2-1-6(12(16)17)3-7(8)13(18)19/h1-3,15H,4-5H2,(H2,10,14) |
| InChIKey | YRARCBMBLQTWJR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 162.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|