C9H8BrN5O3S — CID 19578055
N-(5-bromo-1,3-thiazol-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide (PubChem CID 19578055) has the molecular formula C9H8BrN5O3S and a molecular weight of 346.17 g/mol. Its IUPAC name is N-(5-bromo-1,3-thiazol-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-(5-bromo-1,3-thiazol-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19578055 |
| Molecular Formula | C9H8BrN5O3S |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | N-(5-bromo-1,3-thiazol-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(=O)Nc2ncc(Br)s2)nn1C |
| InChI | InChI=1S/C9H8BrN5O3S/c1-4-7(15(17)18)6(13-14(4)2)8(16)12-9-11-3-5(10)19-9/h3H,1-2H3,(H,11,12,16) |
| InChIKey | ZWBFUBWKGCYKDW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|