C13H12BrN3O — CID 106491133
N-(4-bromo-3,5-dimethylphenyl)pyridazine-4-carboxamide (PubChem CID 106491133) has the molecular formula C13H12BrN3O and a molecular weight of 306.16 g/mol. Its IUPAC name is N-(4-bromo-3,5-dimethylphenyl)pyridazine-4-carboxamide.
| Compound Name | N-(4-bromo-3,5-dimethylphenyl)pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 106491133 |
| Molecular Formula | C13H12BrN3O |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | N-(4-bromo-3,5-dimethylphenyl)pyridazine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccnnc2)cc(C)c1Br |
| InChI | InChI=1S/C13H12BrN3O/c1-8-5-11(6-9(2)12(8)14)17-13(18)10-3-4-15-16-7-10/h3-7H,1-2H3,(H,17,18) |
| InChIKey | XFRGDEWCMMFPAJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |