C11H9N3O4 — CID 63117144
3-amino-4-(1,2-oxazole-3-carbonylamino)benzoic acid (PubChem CID 63117144) has the molecular formula C11H9N3O4 and a molecular weight of 247.21 g/mol. Its IUPAC name is 3-amino-4-(1,2-oxazole-3-carbonylamino)benzoic acid.
| Compound Name | 3-amino-4-(1,2-oxazole-3-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 63117144 |
| Molecular Formula | C11H9N3O4 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-amino-4-(1,2-oxazole-3-carbonylamino)benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1NC(=O)c1ccon1 |
| InChI | InChI=1S/C11H9N3O4/c12-7-5-6(11(16)17)1-2-8(7)13-10(15)9-3-4-18-14-9/h1-5H,12H2,(H,13,15)(H,16,17) |
| InChIKey | IJTHXQJINGXHGO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|