C13H9FN4O2 — CID 10635873
N-(4-amino-7-fluoroquinolin-3-yl)-1,2-oxazole-3-carboxamide (PubChem CID 10635873) has the molecular formula C13H9FN4O2 and a molecular weight of 272.24 g/mol. Its IUPAC name is N-(4-amino-7-fluoroquinolin-3-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-amino-7-fluoroquinolin-3-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 10635873 |
| Molecular Formula | C13H9FN4O2 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | N-(4-amino-7-fluoroquinolin-3-yl)-1,2-oxazole-3-carboxamide |
| SMILES | Nc1c(NC(=O)c2ccon2)cnc2cc(F)ccc12 |
| InChI | InChI=1S/C13H9FN4O2/c14-7-1-2-8-10(5-7)16-6-11(12(8)15)17-13(19)9-3-4-20-18-9/h1-6H,(H2,15,16)(H,17,19) |
| InChIKey | GDLOZCPBGGFNJO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |