C8H11ClN2O2 — CID 83187340
N-(4-chlorobutan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 83187340) has the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(4-chlorobutan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 83187340 |
| Molecular Formula | C8H11ClN2O2 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(CCCl)NC(=O)c1ccon1 |
| InChI | InChI=1S/C8H11ClN2O2/c1-6(2-4-9)10-8(12)7-3-5-13-11-7/h3,5-6H,2,4H2,1H3,(H,10,12) |
| InChIKey | OVWKBURGDRAGBI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|