C19H26N2O2 — CID 46087322
5-(4-tert-butylphenyl)-N-(3-methylbutyl)-1,2-oxazole-3-carboxamide (PubChem CID 46087322) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-N-(3-methylbutyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-tert-butylphenyl)-N-(3-methylbutyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 46087322 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 5-(4-tert-butylphenyl)-N-(3-methylbutyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)CCNC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)on1 |
| InChI | InChI=1S/C19H26N2O2/c1-13(2)10-11-20-18(22)16-12-17(23-21-16)14-6-8-15(9-7-14)19(3,4)5/h6-9,12-13H,10-11H2,1-5H3,(H,20,22) |
| InChIKey | OFAVMHFPWXIJAF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |