C20H27N3O3 — CID 131991756
5-phenyl-N-[2-(2,2,4-trimethylpentanoylamino)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 131991756) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-phenyl-N-[2-(2,2,4-trimethylpentanoylamino)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-phenyl-N-[2-(2,2,4-trimethylpentanoylamino)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 131991756 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 5-phenyl-N-[2-(2,2,4-trimethylpentanoylamino)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)CC(C)(C)C(=O)NCCNC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H27N3O3/c1-14(2)13-20(3,4)19(25)22-11-10-21-18(24)16-12-17(26-23-16)15-8-6-5-7-9-15/h5-9,12,14H,10-11,13H2,1-4H3,(H,21,24)(H,22,25) |
| InChIKey | ZZTRCNQGGWRFSO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|