C13H21NO2S — CID 75390120
3-methyl-N-[3-(2-methylpropylsulfanyl)propyl]furan-2-carboxamide (PubChem CID 75390120) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-methylpropylsulfanyl)propyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[3-(2-methylpropylsulfanyl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 75390120 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-methyl-N-[3-(2-methylpropylsulfanyl)propyl]furan-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCCCSCC(C)C |
| InChI | InChI=1S/C13H21NO2S/c1-10(2)9-17-8-4-6-14-13(15)12-11(3)5-7-16-12/h5,7,10H,4,6,8-9H2,1-3H3,(H,14,15) |
| InChIKey | OJMBWQHOZHMRPX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|