C11H18N2O2 — CID 81479014
3-methyl-N-[2-methyl-3-(methylamino)propyl]furan-2-carboxamide (PubChem CID 81479014) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-methyl-N-[2-methyl-3-(methylamino)propyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[2-methyl-3-(methylamino)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 81479014 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 3-methyl-N-[2-methyl-3-(methylamino)propyl]furan-2-carboxamide |
| SMILES | CNCC(C)CNC(=O)c1occc1C |
| InChI | InChI=1S/C11H18N2O2/c1-8(6-12-3)7-13-11(14)10-9(2)4-5-15-10/h4-5,8,12H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | SJYBJHLIRANGLI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |