C22H34IN5O3S — CID 111774613
N-[3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide (PubChem CID 111774613) has the molecular formula C22H34IN5O3S and a molecular weight of 575.52 g/mol. Its IUPAC name is N-[3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111774613 |
| Molecular Formula | C22H34IN5O3S |
| Molecular Weight | 575.52 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | N-[3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCCNC(=O)c1occc1C.I |
| InChI | InChI=1S/C22H33N5O3S.HI/c1-3-23-22(25-9-5-8-24-21(28)20-17(2)7-12-30-20)26-16-18(19-6-4-15-31-19)27-10-13-29-14-11-27;/h4,6-7,12,15,18H,3,5,8-11,13-14,16H2,1-2H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | KXRZIQBRRRERNR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|