C22H36FIN4O3 — CID 111311923
methyl 7-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide (PubChem CID 111311923) has the molecular formula C22H36FIN4O3 and a molecular weight of 550.46 g/mol. Its IUPAC name is methyl 7-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide.
| Compound Name | methyl 7-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
|---|---|
| PubChem CID | 111311923 |
| Molecular Formula | C22H36FIN4O3 |
| Molecular Weight | 550.46 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | methyl 7-[[N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-N'-methylcarbamimidoyl]amino]heptanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCCC(=O)OC)NCC(c1ccc(F)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C22H35FN4O3.HI/c1-24-22(25-12-6-4-3-5-7-21(28)29-2)26-17-20(27-13-15-30-16-14-27)18-8-10-19(23)11-9-18;/h8-11,20H,3-7,12-17H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | LABNGYOXTISNAC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|