C24H41FN6O — CID 111312164
1-[4-(4-ethylpiperazin-1-yl)butyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111312164) has the molecular formula C24H41FN6O and a molecular weight of 448.63 g/mol. Its IUPAC name is 1-[4-(4-ethylpiperazin-1-yl)butyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[4-(4-ethylpiperazin-1-yl)butyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111312164 |
| Molecular Formula | C24H41FN6O |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 1-[4-(4-ethylpiperazin-1-yl)butyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | CCN1CCN(CCCCN/C(=N\C)NCC(c2ccc(F)cc2)N2CCOCC2)CC1 |
| InChI | InChI=1S/C24H41FN6O/c1-3-29-12-14-30(15-13-29)11-5-4-10-27-24(26-2)28-20-23(31-16-18-32-19-17-31)21-6-8-22(25)9-7-21/h6-9,23H,3-5,10-20H2,1-2H3,(H2,26,27,28) |
| InChIKey | LEUKROBELBHLKH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|