C23H40FIN6O — CID 111311647
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111311647) has the molecular formula C23H40FIN6O and a molecular weight of 562.52 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111311647 |
| Molecular Formula | C23H40FIN6O |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)NCC(c1ccc(F)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C23H39FN6O.HI/c1-25-23(26-9-3-11-29-12-4-10-28(2)13-14-29)27-19-22(30-15-17-31-18-16-30)20-5-7-21(24)8-6-20;/h5-8,22H,3-4,9-19H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | BJVKQFSCLTZYJA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|