C24H36IN7 — CID 111760022
2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111760022) has the molecular formula C24H36IN7 and a molecular weight of 549.51 g/mol. Its IUPAC name is 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760022 |
| Molecular Formula | C24H36IN7 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | 2-[2-(diethylamino)-2-phenylethyl]-1-ethyl-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1ccccc1)N(CC)CC)NCCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C24H35N7.HI/c1-4-25-24(26-17-12-16-23-29-28-22-15-10-11-18-31(22)23)27-19-21(30(5-2)6-3)20-13-8-7-9-14-20;/h7-11,13-15,18,21H,4-6,12,16-17,19H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | WBRSOTDVGBJOND-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|