C16H26IN7O — CID 111767054
2-[[ethylamino-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111767054) has the molecular formula C16H26IN7O and a molecular weight of 459.34 g/mol. Its IUPAC name is 2-[[ethylamino-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111767054 |
| Molecular Formula | C16H26IN7O |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 2-[[ethylamino-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCCCc1nnc2ccccn12.I |
| InChI | InChI=1S/C16H25N7O.HI/c1-4-17-16(19-12-15(24)22(2)3)18-10-7-9-14-21-20-13-8-5-6-11-23(13)14;/h5-6,8,11H,4,7,9-10,12H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | QWQSJEBXSLRNAC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|