C16H27N7O — CID 111653054
1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111653054) has the molecular formula C16H27N7O and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111653054 |
| Molecular Formula | C16H27N7O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C16H27N7O/c1-17-16(18-8-11-22(2)9-6-12-24-3)19-13-15-21-20-14-7-4-5-10-23(14)15/h4-5,7,10H,6,8-9,11-13H2,1-3H3,(H2,17,18,19) |
| InChIKey | WGZIJCGWOSMUAD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|