C15H23IN6O — CID 111707344
2-methyl-1-[2-(3-methylphenoxy)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111707344) has the molecular formula C15H23IN6O and a molecular weight of 430.29 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methylphenoxy)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(3-methylphenoxy)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111707344 |
| Molecular Formula | C15H23IN6O |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-methyl-1-[2-(3-methylphenoxy)ethyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1cccc(C)c1)NCc1ncnn1C.I |
| InChI | InChI=1S/C15H22N6O.HI/c1-12-5-4-6-13(9-12)22-8-7-17-15(16-2)18-10-14-19-11-20-21(14)3;/h4-6,9,11H,7-8,10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | VYZMTXNVONNJEY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|