C16H21IN8 — CID 111705464
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111705464) has the molecular formula C16H21IN8 and a molecular weight of 452.30 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111705464 |
| Molecular Formula | C16H21IN8 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(-n2cccn2)cc1)NCc1ncnn1C.I |
| InChI | InChI=1S/C16H20N8.HI/c1-17-16(19-11-15-20-12-22-23(15)2)18-10-13-4-6-14(7-5-13)24-9-3-8-21-24;/h3-9,12H,10-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | BYTRNZHZAXVDER-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|