C16H24IN5 — CID 110944249
1-butan-2-yl-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110944249) has the molecular formula C16H24IN5 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110944249 |
| Molecular Formula | C16H24IN5 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCc1ccc(-n2cccn2)cc1.I |
| InChI | InChI=1S/C16H23N5.HI/c1-4-13(2)20-16(17-3)18-12-14-6-8-15(9-7-14)21-11-5-10-19-21;/h5-11,13H,4,12H2,1-3H3,(H2,17,18,20);1H |
| InChIKey | ISYZDSBUSOHIRD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|