C13H18BrN5 — CID 75532344
1,2-dimethyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydrobromide (PubChem CID 75532344) has the molecular formula C13H18BrN5 and a molecular weight of 324.23 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydrobromide.
| Compound Name | 1,2-dimethyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydrobromide |
|---|---|
| PubChem CID | 75532344 |
| Molecular Formula | C13H18BrN5 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 1,2-dimethyl-3-[(4-pyrazol-1-ylphenyl)methyl]guanidine;hydrobromide |
| SMILES | Br.C/N=C(\NC)NCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C13H17N5.BrH/c1-14-13(15-2)16-10-11-4-6-12(7-5-11)18-9-3-8-17-18;/h3-9H,10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | DKJHKLPJXVAYEW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|